C13H27N7 — CID 80845861
2-N-[2-(dimethylamino)ethyl]-2-N,4-N,4-N-trimethyl-6-N-propyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80845861) has the molecular formula C13H27N7 and a molecular weight of 281.41 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-2-N,4-N,4-N-trimethyl-6-N-propyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-2-N,4-N,4-N-trimethyl-6-N-propyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80845861 |
| Molecular Formula | C13H27N7 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-2-N,4-N,4-N-trimethyl-6-N-propyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(N(C)C)nc(N(C)CCN(C)C)n1 |
| InChI | InChI=1S/C13H27N7/c1-7-8-14-11-15-12(19(4)5)17-13(16-11)20(6)10-9-18(2)3/h7-10H2,1-6H3,(H,14,15,16,17) |
| InChIKey | GKBAPUMZPIETKY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |