C13H26N6 — CID 66899786
2-N,2-N-dipentyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 66899786) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-N,2-N-dipentyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dipentyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 66899786 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-N,2-N-dipentyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCN(CCCCC)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H26N6/c1-3-5-7-9-19(10-8-6-4-2)13-17-11(14)16-12(15)18-13/h3-10H2,1-2H3,(H4,14,15,16,17,18) |
| InChIKey | GXQOOJLFYHIAJY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|