C15H28N12 — CID 146588416
2-N-[[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]methyl]-2-N-pentyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 146588416) has the molecular formula C15H28N12 and a molecular weight of 376.47 g/mol. Its IUPAC name is 2-N-[[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]methyl]-2-N-pentyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]methyl]-2-N-pentyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146588416 |
| Molecular Formula | C15H28N12 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-N-[[[4-(ethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]methyl]-2-N-pentyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCN(CNc1nc(NC)nc(NCC)n1)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C15H28N12/c1-4-6-7-8-27(15-22-10(16)21-11(17)23-15)9-20-14-25-12(18-3)24-13(26-14)19-5-2/h4-9H2,1-3H3,(H4,16,17,21,22,23)(H3,18,19,20,24,25,26) |
| InChIKey | DAZCFZFEUZNVSH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 168.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|