C9H18N6O — CID 141133676
[(4,6-diamino-1,3,5-triazin-2-yl)-pentylamino]methanol (PubChem CID 141133676) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)-pentylamino]methanol.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)-pentylamino]methanol |
|---|---|
| PubChem CID | 141133676 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)-pentylamino]methanol |
| SMILES | CCCCCN(CO)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H18N6O/c1-2-3-4-5-15(6-16)9-13-7(10)12-8(11)14-9/h16H,2-6H2,1H3,(H4,10,11,12,13,14) |
| InChIKey | MNJPEOUOGUWKNO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|