C13H28N6O7 — CID 67848128
[[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;butan-1-ol (PubChem CID 67848128) has the molecular formula C13H28N6O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;butan-1-ol.
| Compound Name | [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;butan-1-ol |
|---|---|
| PubChem CID | 67848128 |
| Molecular Formula | C13H28N6O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;butan-1-ol |
| SMILES | CCCCO.OCN(CO)c1nc(N(CO)CO)nc(N(CO)CO)n1 |
| InChI | InChI=1S/C9H18N6O6.C4H10O/c16-1-13(2-17)7-10-8(14(3-18)4-19)12-9(11-7)15(5-20)6-21;1-2-3-4-5/h16-21H,1-6H2;5H,2-4H2,1H3 |
| InChIKey | UCBFGCFFKOMINB-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 190.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|