C6H12N6O — CID 18793710
[(4,6-diamino-1,3,5-triazin-2-yl)-ethylamino]methanol (PubChem CID 18793710) has the molecular formula C6H12N6O and a molecular weight of 184.20 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)-ethylamino]methanol.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)-ethylamino]methanol |
|---|---|
| PubChem CID | 18793710 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)-ethylamino]methanol |
| SMILES | CCN(CO)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H12N6O/c1-2-12(3-13)6-10-4(7)9-5(8)11-6/h13H,2-3H2,1H3,(H4,7,8,9,10,11) |
| InChIKey | RIGDBGRUGOMDML-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|