C13H20N6 — CID 146321122
2-N-ethyl-2-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 146321122) has the molecular formula C13H20N6 and a molecular weight of 260.35 g/mol. Its IUPAC name is 2-N-ethyl-2-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-ethyl-2-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146321122 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-N-ethyl-2-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=C/C=C(\C=C/C)CN(CC)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H20N6/c1-4-7-10(8-5-2)9-19(6-3)13-17-11(14)16-12(15)18-13/h4-5,7-8H,1,6,9H2,2-3H3,(H4,14,15,16,17,18)/b8-5-,10-7+ |
| InChIKey | BMKQFMIADHHJDY-OEPUHGBTSA-N |
| XLogP | 1.55 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|