C10H14N6 — CID 157128089
2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 157128089) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 157128089 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1=C(CNc2nc(N)nc(N)n2)C=CC1 |
| InChI | InChI=1S/C10H14N6/c1-6-3-2-4-7(6)5-13-10-15-8(11)14-9(12)16-10/h2,4H,3,5H2,1H3,(H5,11,12,13,14,15,16) |
| InChIKey | YQXZOCMSJOXWEI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |