C7H11ClN6O — CID 103104377
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)-ethylamino]acetamide (PubChem CID 103104377) has the molecular formula C7H11ClN6O and a molecular weight of 230.66 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)-ethylamino]acetamide.
| Compound Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103104377 |
| Molecular Formula | C7H11ClN6O |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C7H11ClN6O/c1-2-14(3-4(9)15)7-12-5(8)11-6(10)13-7/h2-3H2,1H3,(H2,9,15)(H2,10,11,12,13) |
| InChIKey | OFLRSJMERFHOKJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |