C7H9Cl2N5O — CID 103103709
2-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]acetamide (PubChem CID 103103709) has the molecular formula C7H9Cl2N5O and a molecular weight of 250.09 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]acetamide.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103103709 |
| Molecular Formula | C7H9Cl2N5O |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H9Cl2N5O/c1-2-14(3-4(10)15)7-12-5(8)11-6(9)13-7/h2-3H2,1H3,(H2,10,15) |
| InChIKey | GDMXZYPKNBITME-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |