C7H10ClN3OS — CID 103103685
2-[(4-chloro-1,3-thiazol-2-yl)-ethylamino]acetamide (PubChem CID 103103685) has the molecular formula C7H10ClN3OS and a molecular weight of 219.70 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)-ethylamino]acetamide.
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103103685 |
| Molecular Formula | C7H10ClN3OS |
| Molecular Weight | 219.70 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C7H10ClN3OS/c1-2-11(3-6(9)12)7-10-5(8)4-13-7/h4H,2-3H2,1H3,(H2,9,12) |
| InChIKey | CANXJKJXKBLEJG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.70 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |