C6H12N6 — CID 19357503
2-N-ethyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 19357503) has the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-N-ethyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-ethyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19357503 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-N-ethyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(N)nc(NC)n1 |
| InChI | InChI=1S/C6H12N6/c1-3-9-6-11-4(7)10-5(8-2)12-6/h3H2,1-2H3,(H4,7,8,9,10,11,12) |
| InChIKey | VZJOGDYZRPMGSG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |