C10H23N12O3P — CID 173065956
ethylphosphonic acid;bis(2-N-methyl-1,3,5-triazine-2,4,6-triamine) (PubChem CID 173065956) has the molecular formula C10H23N12O3P and a molecular weight of 390.35 g/mol. Its IUPAC name is ethylphosphonic acid;bis(2-N-methyl-1,3,5-triazine-2,4,6-triamine).
| Compound Name | ethylphosphonic acid;bis(2-N-methyl-1,3,5-triazine-2,4,6-triamine) |
|---|---|
| PubChem CID | 173065956 |
| Molecular Formula | C10H23N12O3P |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethylphosphonic acid;bis(2-N-methyl-1,3,5-triazine-2,4,6-triamine) |
| SMILES | CCP(=O)(O)O.CNc1nc(N)nc(N)n1.CNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/2C4H8N6.C2H7O3P/c2*1-7-4-9-2(5)8-3(6)10-4;1-2-6(3,4)5/h2*1H3,(H5,5,6,7,8,9,10);2H2,1H3,(H2,3,4,5) |
| InChIKey | YBDWUHFAJLMSGR-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 263.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|