C4H6N6O — CID 174411106
2-N-methyl-6-nitroso-1,3,5-triazine-2,4-diamine (PubChem CID 174411106) has the molecular formula C4H6N6O and a molecular weight of 154.13 g/mol. Its IUPAC name is 2-N-methyl-6-nitroso-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-methyl-6-nitroso-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 174411106 |
| Molecular Formula | C4H6N6O |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-N-methyl-6-nitroso-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N)nc(N=O)n1 |
| InChI | InChI=1S/C4H6N6O/c1-6-3-7-2(5)8-4(9-3)10-11/h1H3,(H3,5,6,7,8,9) |
| InChIKey | FINZCQATFRCTRF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |