C27H36N4S2 — CID 635465
N,N-dihexyl-4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 635465) has the molecular formula C27H36N4S2 and a molecular weight of 480.75 g/mol. Its IUPAC name is N,N-dihexyl-4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N,N-dihexyl-4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 635465 |
| Molecular Formula | C27H36N4S2 |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N,N-dihexyl-4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCCCCCN(CCCCCC)c1nc(Sc2ccccc2)nc(Sc2ccccc2)n1 |
| InChI | InChI=1S/C27H36N4S2/c1-3-5-7-15-21-31(22-16-8-6-4-2)25-28-26(32-23-17-11-9-12-18-23)30-27(29-25)33-24-19-13-10-14-20-24/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3 |
| InChIKey | QRYYZUTUUHIPFG-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|