C23H28N4O2S — CID 136759395
2-[4-(octylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]benzene-1,4-diol (PubChem CID 136759395) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[4-(octylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]benzene-1,4-diol.
| Compound Name | 2-[4-(octylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136759395 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[4-(octylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]benzene-1,4-diol |
| SMILES | CCCCCCCCNc1nc(Sc2ccccc2)nc(-c2cc(O)ccc2O)n1 |
| InChI | InChI=1S/C23H28N4O2S/c1-2-3-4-5-6-10-15-24-22-25-21(19-16-17(28)13-14-20(19)29)26-23(27-22)30-18-11-8-7-9-12-18/h7-9,11-14,16,28-29H,2-6,10,15H2,1H3,(H,24,25,26,27) |
| InChIKey | GFSBBWCPUDKBPL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|