C19H27N11S2 — CID 126546702
2-[[4-[2-[[4-(2-aminoethylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]amino]ethanethiol (PubChem CID 126546702) has the molecular formula C19H27N11S2 and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-[[4-[2-[[4-(2-aminoethylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]amino]ethanethiol.
| Compound Name | 2-[[4-[2-[[4-(2-aminoethylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]amino]ethanethiol |
|---|---|
| PubChem CID | 126546702 |
| Molecular Formula | C19H27N11S2 |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[[4-[2-[[4-(2-aminoethylamino)-6-phenylsulfanyl-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]amino]ethanethiol |
| SMILES | Cc1nc(NCCS)nc(NCCNc2nc(NCCN)nc(Sc3ccccc3)n2)n1 |
| InChI | InChI=1S/C19H27N11S2/c1-13-25-15(27-16(26-13)24-11-12-31)22-9-10-23-18-28-17(21-8-7-20)29-19(30-18)32-14-5-3-2-4-6-14/h2-6,31H,7-12,20H2,1H3,(H2,21,23,28,29,30)(H2,22,24,25,26,27) |
| InChIKey | QTSUPANTHJZNSW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|