C16H31N13S — CID 126546684
4-N-(2-aminoethyl)-2-N-[2-[[4-(2-aminoethylamino)-6-ethylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl]-6-N-ethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 126546684) has the molecular formula C16H31N13S and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)-2-N-[2-[[4-(2-aminoethylamino)-6-ethylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl]-6-N-ethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2-aminoethyl)-2-N-[2-[[4-(2-aminoethylamino)-6-ethylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl]-6-N-ethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 126546684 |
| Molecular Formula | C16H31N13S |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 4-N-(2-aminoethyl)-2-N-[2-[[4-(2-aminoethylamino)-6-ethylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl]-6-N-ethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCCN)nc(NCCNc2nc(NCCN)nc(SCC)n2)n1 |
| InChI | InChI=1S/C16H31N13S/c1-3-19-11-24-12(20-7-5-17)26-13(25-11)22-9-10-23-15-27-14(21-8-6-18)28-16(29-15)30-4-2/h3-10,17-18H2,1-2H3,(H2,21,23,27,28,29)(H3,19,20,22,24,25,26) |
| InChIKey | UNINNIDZFXVVLR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|