C10H21N7O3S2 — CID 90250674
3-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid (PubChem CID 90250674) has the molecular formula C10H21N7O3S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 3-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid.
| Compound Name | 3-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90250674 |
| Molecular Formula | C10H21N7O3S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid |
| SMILES | NCCNc1nc(NCCN)nc(SCCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C10H21N7O3S2/c11-2-4-13-8-15-9(14-5-3-12)17-10(16-8)21-6-1-7-22(18,19)20/h1-7,11-12H2,(H,18,19,20)(H2,13,14,15,16,17) |
| InChIKey | UQCKLGNRLKCTRX-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 169.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|