C11H24N8 — CID 118119736
2-N,4-N-bis(2-aminoethyl)-6-N-butyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 118119736) has the molecular formula C11H24N8 and a molecular weight of 268.37 g/mol. Its IUPAC name is 2-N,4-N-bis(2-aminoethyl)-6-N-butyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(2-aminoethyl)-6-N-butyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 118119736 |
| Molecular Formula | C11H24N8 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 2-N,4-N-bis(2-aminoethyl)-6-N-butyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(NCCN)nc(NCCN)n1 |
| InChI | InChI=1S/C11H24N8/c1-2-3-6-14-9-17-10(15-7-4-12)19-11(18-9)16-8-5-13/h2-8,12-13H2,1H3,(H3,14,15,16,17,18,19) |
| InChIKey | WWXDXVDQBDLBSW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|