C21H26N6O12S5 — CID 160821554
2-[[4-[3-amino-4-(3-sulfopropylsulfanyl)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]benzenesulfonic acid;sulfur trioxide (PubChem CID 160821554) has the molecular formula C21H26N6O12S5 and a molecular weight of 714.80 g/mol. Its IUPAC name is 2-[[4-[3-amino-4-(3-sulfopropylsulfanyl)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]benzenesulfonic acid;sulfur trioxide.
| Compound Name | 2-[[4-[3-amino-4-(3-sulfopropylsulfanyl)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]benzenesulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 160821554 |
| Molecular Formula | C21H26N6O12S5 |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.02 |
| IUPAC Name | 2-[[4-[3-amino-4-(3-sulfopropylsulfanyl)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]benzenesulfonic acid;sulfur trioxide |
| SMILES | Nc1cc(Nc2nc(Cc3ccccc3S(=O)(=O)O)nc(NCCS(=O)(=O)O)n2)ccc1SCCCS(=O)(=O)O.O=S(=O)=O |
| InChI | InChI=1S/C21H26N6O9S4.O3S/c22-16-13-15(6-7-17(16)37-9-3-10-38(28,29)30)24-21-26-19(25-20(27-21)23-8-11-39(31,32)33)12-14-4-1-2-5-18(14)40(34,35)36;1-4(2)3/h1-2,4-7,13H,3,8-12,22H2,(H,28,29,30)(H,31,32,33)(H,34,35,36)(H2,23,24,25,26,27); |
| InChIKey | SFPPJCHWGABZEY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 303.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.80 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|