C11H16N2O4S2 — CID 87693576
3-(4-acetamido-2-aminophenyl)sulfanylpropane-1-sulfonic acid (PubChem CID 87693576) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(4-acetamido-2-aminophenyl)sulfanylpropane-1-sulfonic acid.
| Compound Name | 3-(4-acetamido-2-aminophenyl)sulfanylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87693576 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-(4-acetamido-2-aminophenyl)sulfanylpropane-1-sulfonic acid |
| SMILES | CC(=O)Nc1ccc(SCCCS(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-8(14)13-9-3-4-11(10(12)7-9)18-5-2-6-19(15,16)17/h3-4,7H,2,5-6,12H2,1H3,(H,13,14)(H,15,16,17) |
| InChIKey | WDHOEBFNAQYDJY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|