C15H22N6O5S2 — CID 54600381
sulfuric acid;N-[4-[3-(2,4,6-triaminopyrimidin-5-yl)propylsulfanyl]phenyl]acetamide (PubChem CID 54600381) has the molecular formula C15H22N6O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is sulfuric acid;N-[4-[3-(2,4,6-triaminopyrimidin-5-yl)propylsulfanyl]phenyl]acetamide.
| Compound Name | sulfuric acid;N-[4-[3-(2,4,6-triaminopyrimidin-5-yl)propylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54600381 |
| Molecular Formula | C15H22N6O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | sulfuric acid;N-[4-[3-(2,4,6-triaminopyrimidin-5-yl)propylsulfanyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCCCc2c(N)nc(N)nc2N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H20N6OS.H2O4S/c1-9(22)19-10-4-6-11(7-5-10)23-8-2-3-12-13(16)20-15(18)21-14(12)17;1-5(2,3)4/h4-7H,2-3,8H2,1H3,(H,19,22)(H6,16,17,18,20,21);(H2,1,2,3,4) |
| InChIKey | VHROHSXSKWKTJQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 207.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|