C24H24F3N3O4S3 — CID 175602052
1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[3-[4-(trifluoromethylsulfanyl)phenyl]propylsulfanyl]phenyl]urea (PubChem CID 175602052) has the molecular formula C24H24F3N3O4S3 and a molecular weight of 571.67 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[3-[4-(trifluoromethylsulfanyl)phenyl]propylsulfanyl]phenyl]urea.
| Compound Name | 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[3-[4-(trifluoromethylsulfanyl)phenyl]propylsulfanyl]phenyl]urea |
|---|---|
| PubChem CID | 175602052 |
| Molecular Formula | C24H24F3N3O4S3 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[3-[4-(trifluoromethylsulfanyl)phenyl]propylsulfanyl]phenyl]urea |
| SMILES | CS(=O)(=O)Nc1cc(NC(=O)Nc2ccc(SCCCc3ccc(SC(F)(F)F)cc3)cc2)ccc1O |
| InChI | InChI=1S/C24H24F3N3O4S3/c1-37(33,34)30-21-15-18(8-13-22(21)31)29-23(32)28-17-6-11-19(12-7-17)35-14-2-3-16-4-9-20(10-5-16)36-24(25,26)27/h4-13,15,30-31H,2-3,14H2,1H3,(H2,28,29,32) |
| InChIKey | MIYHFJSRVUGJPB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|