C18H18F6N2O3S — CID 88853691
N-[5-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 88853691) has the molecular formula C18H18F6N2O3S and a molecular weight of 456.41 g/mol. Its IUPAC name is N-[5-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 88853691 |
| Molecular Formula | C18H18F6N2O3S |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[5-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(CCNCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1O |
| InChI | InChI=1S/C18H18F6N2O3S/c1-30(28,29)26-15-8-11(2-3-16(15)27)4-5-25-10-12-6-13(17(19,20)21)9-14(7-12)18(22,23)24/h2-3,6-9,25-27H,4-5,10H2,1H3 |
| InChIKey | CFJCQAZQNXTOES-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|