C22H19ClF3N3O5S2 — CID 171487870
1-[4-[[2-chloro-4-(trifluoromethylsulfanyl)phenoxy]methyl]phenyl]-3-[4-hydroxy-3-(methanesulfonamido)phenyl]urea (PubChem CID 171487870) has the molecular formula C22H19ClF3N3O5S2 and a molecular weight of 561.99 g/mol. Its IUPAC name is 1-[4-[[2-chloro-4-(trifluoromethylsulfanyl)phenoxy]methyl]phenyl]-3-[4-hydroxy-3-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-[4-[[2-chloro-4-(trifluoromethylsulfanyl)phenoxy]methyl]phenyl]-3-[4-hydroxy-3-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 171487870 |
| Molecular Formula | C22H19ClF3N3O5S2 |
| Molecular Weight | 561.99 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 1-[4-[[2-chloro-4-(trifluoromethylsulfanyl)phenoxy]methyl]phenyl]-3-[4-hydroxy-3-(methanesulfonamido)phenyl]urea |
| SMILES | CS(=O)(=O)Nc1cc(NC(=O)Nc2ccc(COc3ccc(SC(F)(F)F)cc3Cl)cc2)ccc1O |
| InChI | InChI=1S/C22H19ClF3N3O5S2/c1-36(32,33)29-18-10-15(6-8-19(18)30)28-21(31)27-14-4-2-13(3-5-14)12-34-20-9-7-16(11-17(20)23)35-22(24,25)26/h2-11,29-30H,12H2,1H3,(H2,27,28,31) |
| InChIKey | FLJBWUXTYIKJBW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|