C25H22F4N2O7S2 — CID 175601941
ethyl 2-[[5-[[3-fluoro-4-[[4-(trifluoromethylsulfanyl)phenoxy]methyl]benzoyl]amino]-2-hydroxyphenyl]sulfamoyl]acetate (PubChem CID 175601941) has the molecular formula C25H22F4N2O7S2 and a molecular weight of 602.58 g/mol. Its IUPAC name is ethyl 2-[[5-[[3-fluoro-4-[[4-(trifluoromethylsulfanyl)phenoxy]methyl]benzoyl]amino]-2-hydroxyphenyl]sulfamoyl]acetate.
| Compound Name | ethyl 2-[[5-[[3-fluoro-4-[[4-(trifluoromethylsulfanyl)phenoxy]methyl]benzoyl]amino]-2-hydroxyphenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 175601941 |
| Molecular Formula | C25H22F4N2O7S2 |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | ethyl 2-[[5-[[3-fluoro-4-[[4-(trifluoromethylsulfanyl)phenoxy]methyl]benzoyl]amino]-2-hydroxyphenyl]sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1cc(NC(=O)c2ccc(COc3ccc(SC(F)(F)F)cc3)c(F)c2)ccc1O |
| InChI | InChI=1S/C25H22F4N2O7S2/c1-2-37-23(33)14-40(35,36)31-21-12-17(5-10-22(21)32)30-24(34)15-3-4-16(20(26)11-15)13-38-18-6-8-19(9-7-18)39-25(27,28)29/h3-12,31-32H,2,13-14H2,1H3,(H,30,34) |
| InChIKey | DMNAYWNQRVZNFZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|