C17H15F3N2O3S — CID 26705416
N-(5-acetamido-2-methoxyphenyl)-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 26705416) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 26705416 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N2O3S/c1-10(23)21-12-5-8-15(25-2)14(9-12)22-16(24)11-3-6-13(7-4-11)26-17(18,19)20/h3-9H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | CMUMEKHJUDEYPY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |