C23H22F3N3O6S — CID 175601991
1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]urea (PubChem CID 175601991) has the molecular formula C23H22F3N3O6S and a molecular weight of 525.51 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]urea.
| Compound Name | 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 175601991 |
| Molecular Formula | C23H22F3N3O6S |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-[4-hydroxy-3-(methanesulfonamido)phenyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]urea |
| SMILES | CC(Oc1ccc(NC(=O)Nc2ccc(O)c(NS(C)(=O)=O)c2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F3N3O6S/c1-14(15-3-8-19(9-4-15)35-23(24,25)26)34-18-10-5-16(6-11-18)27-22(31)28-17-7-12-21(30)20(13-17)29-36(2,32)33/h3-14,29-30H,1-2H3,(H2,27,28,31) |
| InChIKey | BGJNNYYAJOXHJG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|