C10H13NOS2 — CID 117033736
N-[4-(2-sulfanylethylsulfanyl)phenyl]acetamide (PubChem CID 117033736) has the molecular formula C10H13NOS2 and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[4-(2-sulfanylethylsulfanyl)phenyl]acetamide.
| Compound Name | N-[4-(2-sulfanylethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 117033736 |
| Molecular Formula | C10H13NOS2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | N-[4-(2-sulfanylethylsulfanyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCCS)cc1 |
| InChI | InChI=1S/C10H13NOS2/c1-8(12)11-9-2-4-10(5-3-9)14-7-6-13/h2-5,13H,6-7H2,1H3,(H,11,12) |
| InChIKey | UUCCXGRYVGVZPP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|