C12H16N2O2S — CID 35964472
2-(4-acetamidophenyl)sulfanyl-N-ethylacetamide (PubChem CID 35964472) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-ethylacetamide.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-ethylacetamide |
|---|---|
| PubChem CID | 35964472 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-ethylacetamide |
| SMILES | CCNC(=O)CSc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-3-13-12(16)8-17-11-6-4-10(5-7-11)14-9(2)15/h4-7H,3,8H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | KOYLUBKNADNHSL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |