potassium 2-(4-acetamidophenyl)sulfanylacetate

C10H10KNO3S — CID 23700024

IUPACpotassium 2-(4-acetamidophenyl)sulfanylacetate
SMILESCC(=O)Nc1ccc(SCC(=O)[O-])cc1.[K+]
InChIInChI=1S/C10H11NO3S.K/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14;/h2-5H,6H2,1H3,(H,11,12)(H,13,14);/q;+1/p-1
InChIKeyRGGQDGRKURHWRL-UHFFFAOYSA-M
MW263.36 g/mol
LogP-2.51
Rot. Bonds4

About potassium 2-(4-acetamidophenyl)sulfanylacetate

potassium 2-(4-acetamidophenyl)sulfanylacetate (PubChem CID 23700024) has the molecular formula C10H10KNO3S and a molecular weight of 263.36 g/mol. Its IUPAC name is potassium 2-(4-acetamidophenyl)sulfanylacetate.

Molecular Properties

Compound Namepotassium 2-(4-acetamidophenyl)sulfanylacetate
PubChem CID23700024
Molecular FormulaC10H10KNO3S
Molecular Weight263.36 g/mol
Exact Mass263.00
IUPAC Namepotassium 2-(4-acetamidophenyl)sulfanylacetate
SMILESCC(=O)Nc1ccc(SCC(=O)[O-])cc1.[K+]
InChIInChI=1S/C10H11NO3S.K/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14;/h2-5H,6H2,1H3,(H,11,12)(H,13,14);/q;+1/p-1
InChIKeyRGGQDGRKURHWRL-UHFFFAOYSA-M
XLogP-2.51
TPSA69.23 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.36
LogP ≤ 5-2.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze potassium 2-(4-acetamidophenyl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-(4-acetamidophenyl)sulfanylacetate?
The IUPAC name of potassium 2-(4-acetamidophenyl)sulfanylacetate (CID 23700024) is potassium 2-(4-acetamidophenyl)sulfanylacetate.
What is the SMILES notation for potassium 2-(4-acetamidophenyl)sulfanylacetate?
The canonical SMILES for potassium 2-(4-acetamidophenyl)sulfanylacetate is CC(=O)Nc1ccc(SCC(=O)[O-])cc1.[K+].
What is the InChIKey of potassium 2-(4-acetamidophenyl)sulfanylacetate?
The InChIKey is RGGQDGRKURHWRL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H11NO3S.K/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14;/h2-5H,6H2,1H3,(H,11,12)(H,13,14);/q;+1/p-1.
What are the key properties of potassium 2-(4-acetamidophenyl)sulfanylacetate?
potassium 2-(4-acetamidophenyl)sulfanylacetate has a molecular weight of 263.36 g/mol, XLogP of -2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-(4-acetamidophenyl)sulfanylacetate is sourced from PubChem (CID 23700024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).