C10H10KNO3S — CID 23700024
potassium 2-(4-acetamidophenyl)sulfanylacetate (PubChem CID 23700024) has the molecular formula C10H10KNO3S and a molecular weight of 263.36 g/mol. Its IUPAC name is potassium 2-(4-acetamidophenyl)sulfanylacetate.
| Compound Name | potassium 2-(4-acetamidophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 23700024 |
| Molecular Formula | C10H10KNO3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | potassium 2-(4-acetamidophenyl)sulfanylacetate |
| SMILES | CC(=O)Nc1ccc(SCC(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C10H11NO3S.K/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14;/h2-5H,6H2,1H3,(H,11,12)(H,13,14);/q;+1/p-1 |
| InChIKey | RGGQDGRKURHWRL-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |