C21H27N7O9S3 — CID 101145582
2-amino-4-[[4-(2-ethylanilino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 101145582) has the molecular formula C21H27N7O9S3 and a molecular weight of 617.69 g/mol. Its IUPAC name is 2-amino-4-[[4-(2-ethylanilino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-(2-ethylanilino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 101145582 |
| Molecular Formula | C21H27N7O9S3 |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 2-amino-4-[[4-(2-ethylanilino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CCc1ccccc1Nc1nc(NCCS(=O)(=O)CCOS(=O)(=O)O)nc(Nc2ccc(S(=O)(=O)O)c(N)c2)n1 |
| InChI | InChI=1S/C21H27N7O9S3/c1-2-14-5-3-4-6-17(14)25-21-27-19(23-9-11-38(29,30)12-10-37-40(34,35)36)26-20(28-21)24-15-7-8-18(16(22)13-15)39(31,32)33/h3-8,13H,2,9-12,22H2,1H3,(H,31,32,33)(H,34,35,36)(H3,23,24,25,26,27,28) |
| InChIKey | WSLUSNSSJWLJCB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 252.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|