C15H19N7O7S — CID 59787572
5-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 59787572) has the molecular formula C15H19N7O7S and a molecular weight of 441.43 g/mol. Its IUPAC name is 5-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59787572 |
| Molecular Formula | C15H19N7O7S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 5-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | NCCNc1nc(NCCS(=O)(=O)O)nc(Nc2cc(C(=O)O)cc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C15H19N7O7S/c16-1-2-17-13-20-14(18-3-4-30(27,28)29)22-15(21-13)19-10-6-8(11(23)24)5-9(7-10)12(25)26/h5-7H,1-4,16H2,(H,23,24)(H,25,26)(H,27,28,29)(H3,17,18,19,20,21,22) |
| InChIKey | PTTPSIWYKRJUBP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 229.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|