C9H16N4S2 — CID 118921040
N-ethyl-4,6-bis(ethylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 118921040) has the molecular formula C9H16N4S2 and a molecular weight of 244.39 g/mol. Its IUPAC name is N-ethyl-4,6-bis(ethylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4,6-bis(ethylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118921040 |
| Molecular Formula | C9H16N4S2 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-ethyl-4,6-bis(ethylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(SCC)nc(SCC)n1 |
| InChI | InChI=1S/C9H16N4S2/c1-4-10-7-11-8(14-5-2)13-9(12-7)15-6-3/h4-6H2,1-3H3,(H,10,11,12,13) |
| InChIKey | OFLGMFLCGPAPBM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |