C9H18N6S — CID 145028921
6-ethylsulfanyl-4-N-methyl-2-N-[2-(methylamino)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 145028921) has the molecular formula C9H18N6S and a molecular weight of 242.35 g/mol. Its IUPAC name is 6-ethylsulfanyl-4-N-methyl-2-N-[2-(methylamino)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethylsulfanyl-4-N-methyl-2-N-[2-(methylamino)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 145028921 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 6-ethylsulfanyl-4-N-methyl-2-N-[2-(methylamino)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCSc1nc(NC)nc(NCCNC)n1 |
| InChI | InChI=1S/C9H18N6S/c1-4-16-9-14-7(11-3)13-8(15-9)12-6-5-10-2/h10H,4-6H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | VVICXBQLXGZVJF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|