C17H33N5S — CID 118932888
N'-(4-decylsulfanyl-6-methyl-1,3,5-triazin-2-yl)-N-methylethane-1,2-diamine (PubChem CID 118932888) has the molecular formula C17H33N5S and a molecular weight of 339.55 g/mol. Its IUPAC name is N'-(4-decylsulfanyl-6-methyl-1,3,5-triazin-2-yl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(4-decylsulfanyl-6-methyl-1,3,5-triazin-2-yl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 118932888 |
| Molecular Formula | C17H33N5S |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | N'-(4-decylsulfanyl-6-methyl-1,3,5-triazin-2-yl)-N-methylethane-1,2-diamine |
| SMILES | CCCCCCCCCCSc1nc(C)nc(NCCNC)n1 |
| InChI | InChI=1S/C17H33N5S/c1-4-5-6-7-8-9-10-11-14-23-17-21-15(2)20-16(22-17)19-13-12-18-3/h18H,4-14H2,1-3H3,(H,19,20,21,22) |
| InChIKey | IWCBHWMJBQZVFM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|