C14H27N5S — CID 80884317
6-butylsulfanyl-2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80884317) has the molecular formula C14H27N5S and a molecular weight of 297.47 g/mol. Its IUPAC name is 6-butylsulfanyl-2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-butylsulfanyl-2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80884317 |
| Molecular Formula | C14H27N5S |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 6-butylsulfanyl-2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCSc1nc(NCCC)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C14H27N5S/c1-5-9-11-20-14-17-12(15-10-6-2)16-13(18-14)19(7-3)8-4/h5-11H2,1-4H3,(H,15,16,17,18) |
| InChIKey | ACZVMDAFYGFYCQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|