C24H44N10S4 — CID 110191274
6-[6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]disulfanyl]hexyldisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine (PubChem CID 110191274) has the molecular formula C24H44N10S4 and a molecular weight of 600.95 g/mol. Its IUPAC name is 6-[6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]disulfanyl]hexyldisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]disulfanyl]hexyldisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110191274 |
| Molecular Formula | C24H44N10S4 |
| Molecular Weight | 600.95 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 6-[6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]disulfanyl]hexyldisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(SSCCCCCCSSc2nc(NCC)nc(N(CC)CC)n2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C24H44N10S4/c1-7-25-19-27-21(33(9-3)10-4)31-23(29-19)37-35-17-15-13-14-16-18-36-38-24-30-20(26-8-2)28-22(32-24)34(11-5)12-6/h7-18H2,1-6H3,(H,25,27,29,31)(H,26,28,30,32) |
| InChIKey | BARLBEYVYZNYHJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|