C13H20N6OS — CID 106928502
2-N,2-N,4-N-triethyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 106928502) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-N,2-N,4-N-triethyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-triethyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106928502 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-N,2-N,4-N-triethyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Sc2nc(C)co2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C13H20N6OS/c1-5-14-10-16-11(19(6-2)7-3)18-12(17-10)21-13-15-9(4)8-20-13/h8H,5-7H2,1-4H3,(H,14,16,17,18) |
| InChIKey | XKNPNQSRNQRRDR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |