C12H19N7S2 — CID 80873629
2-N,2-N,4-N-triethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 80873629) has the molecular formula C12H19N7S2 and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-N,2-N,4-N-triethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-triethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80873629 |
| Molecular Formula | C12H19N7S2 |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-N,2-N,4-N-triethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Sc2nnc(C)s2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C12H19N7S2/c1-5-13-9-14-10(19(6-2)7-3)16-11(15-9)21-12-18-17-8(4)20-12/h5-7H2,1-4H3,(H,13,14,15,16) |
| InChIKey | ZPAZUXRVPSFQBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |