C22H40N10S4 — CID 19816358
6-[[4-(dipropylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]tetrasulfanyl]-4-N-ethyl-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine (PubChem CID 19816358) has the molecular formula C22H40N10S4 and a molecular weight of 572.90 g/mol. Its IUPAC name is 6-[[4-(dipropylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]tetrasulfanyl]-4-N-ethyl-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[4-(dipropylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]tetrasulfanyl]-4-N-ethyl-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19816358 |
| Molecular Formula | C22H40N10S4 |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 6-[[4-(dipropylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]tetrasulfanyl]-4-N-ethyl-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(NCC)nc(SSSSc2nc(NCC)nc(N(CCC)CCC)n2)n1 |
| InChI | InChI=1S/C22H40N10S4/c1-7-13-31(14-8-2)19-25-17(23-11-5)27-21(29-19)33-35-36-34-22-28-18(24-12-6)26-20(30-22)32(15-9-3)16-10-4/h7-16H2,1-6H3,(H,23,25,27,29)(H,24,26,28,30) |
| InChIKey | MZHYLGKXDVVDLC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|