C18H32N10S3 — CID 54292707
6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]trisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine (PubChem CID 54292707) has the molecular formula C18H32N10S3 and a molecular weight of 484.73 g/mol. Its IUPAC name is 6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]trisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]trisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54292707 |
| Molecular Formula | C18H32N10S3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 6-[[4-(diethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]trisulfanyl]-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(SSSc2nc(NCC)nc(N(CC)CC)n2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C18H32N10S3/c1-7-19-13-21-15(27(9-3)10-4)25-17(23-13)29-31-30-18-24-14(20-8-2)22-16(26-18)28(11-5)12-6/h7-12H2,1-6H3,(H,19,21,23,25)(H,20,22,24,26) |
| InChIKey | RYQCOJOZADMAGZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|