C13H26N6 — CID 80764116
2-N,2-N,6-N-triethyl-4-N-methyl-4-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80764116) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-N,2-N,6-N-triethyl-4-N-methyl-4-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-triethyl-4-N-methyl-4-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80764116 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-N,2-N,6-N-triethyl-4-N-methyl-4-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(N(CC)CC)nc(N(C)C(C)C)n1 |
| InChI | InChI=1S/C13H26N6/c1-7-14-11-15-12(18(6)10(4)5)17-13(16-11)19(8-2)9-3/h10H,7-9H2,1-6H3,(H,14,15,16,17) |
| InChIKey | LDEVKFZONDTDNO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |