C12H24N6O — CID 80808890
6-N-ethyl-2-N-(1-methoxypropan-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80808890) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-N-ethyl-2-N-(1-methoxypropan-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-ethyl-2-N-(1-methoxypropan-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80808890 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 6-N-ethyl-2-N-(1-methoxypropan-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(N(C)C)nc(N(C)C(C)COC)n1 |
| InChI | InChI=1S/C12H24N6O/c1-7-13-10-14-11(17(3)4)16-12(15-10)18(5)9(2)8-19-6/h9H,7-8H2,1-6H3,(H,13,14,15,16) |
| InChIKey | JOLJNYCHUIJEDP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |