C11H21N5OS — CID 80890395
3-[[4-(diethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]sulfanyl]propan-1-ol (PubChem CID 80890395) has the molecular formula C11H21N5OS and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-[[4-(diethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[4-(diethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 80890395 |
| Molecular Formula | C11H21N5OS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-[[4-(diethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]sulfanyl]propan-1-ol |
| SMILES | CCN(CC)c1nc(NC)nc(SCCCO)n1 |
| InChI | InChI=1S/C11H21N5OS/c1-4-16(5-2)10-13-9(12-3)14-11(15-10)18-8-6-7-17/h17H,4-8H2,1-3H3,(H,12,13,14,15) |
| InChIKey | YCFJWQWEWAIHLX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|