C19H31N9O4S2 — CID 145028945
3-[[4-[2-[[4-(2-carboxyethylsulfanyl)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]sulfanyl]propanoic acid;ethane (PubChem CID 145028945) has the molecular formula C19H31N9O4S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 3-[[4-[2-[[4-(2-carboxyethylsulfanyl)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]sulfanyl]propanoic acid;ethane.
| Compound Name | 3-[[4-[2-[[4-(2-carboxyethylsulfanyl)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]sulfanyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 145028945 |
| Molecular Formula | C19H31N9O4S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 3-[[4-[2-[[4-(2-carboxyethylsulfanyl)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethylamino]-6-methyl-1,3,5-triazin-2-yl]sulfanyl]propanoic acid;ethane |
| SMILES | CC.CCNc1nc(NCCNc2nc(C)nc(SCCC(=O)O)n2)nc(SCCC(=O)O)n1 |
| InChI | InChI=1S/C17H25N9O4S2.C2H6/c1-3-18-13-23-15(26-17(24-13)32-9-5-12(29)30)20-7-6-19-14-21-10(2)22-16(25-14)31-8-4-11(27)28;1-2/h3-9H2,1-2H3,(H,27,28)(H,29,30)(H,19,21,22,25)(H2,18,20,23,24,26);1-2H3 |
| InChIKey | UQSLGEFCWATBPN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 188.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|