C10H14N6O2S — CID 655506
ethyl 2-[[4-(cyanoamino)-6-(ethylamino)-1,3,5-triazin-2-yl]sulfanyl]acetate (PubChem CID 655506) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is ethyl 2-[[4-(cyanoamino)-6-(ethylamino)-1,3,5-triazin-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[4-(cyanoamino)-6-(ethylamino)-1,3,5-triazin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 655506 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | ethyl 2-[[4-(cyanoamino)-6-(ethylamino)-1,3,5-triazin-2-yl]sulfanyl]acetate |
| SMILES | CCNc1nc(NC#N)nc(SCC(=O)OCC)n1 |
| InChI | InChI=1S/C10H14N6O2S/c1-3-12-8-14-9(13-6-11)16-10(15-8)19-5-7(17)18-4-2/h3-5H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | QOFKBAOGEUDJJQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|