C8H13N7 — CID 12539665
[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]cyanamide (PubChem CID 12539665) has the molecular formula C8H13N7 and a molecular weight of 207.24 g/mol. Its IUPAC name is [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]cyanamide.
| Compound Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]cyanamide |
|---|---|
| PubChem CID | 12539665 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]cyanamide |
| SMILES | CCNc1nc(NC#N)nc(NCC)n1 |
| InChI | InChI=1S/C8H13N7/c1-3-10-6-13-7(11-4-2)15-8(14-6)12-5-9/h3-4H2,1-2H3,(H3,10,11,12,13,14,15) |
| InChIKey | KWSNFJOAMVWOFM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|