C5H7N7 — CID 59064757
(4,5,6-triaminopyrimidin-2-yl)cyanamide (PubChem CID 59064757) has the molecular formula C5H7N7 and a molecular weight of 165.16 g/mol. Its IUPAC name is (4,5,6-triaminopyrimidin-2-yl)cyanamide.
| Compound Name | (4,5,6-triaminopyrimidin-2-yl)cyanamide |
|---|---|
| PubChem CID | 59064757 |
| Molecular Formula | C5H7N7 |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (4,5,6-triaminopyrimidin-2-yl)cyanamide |
| SMILES | N#CNc1nc(N)c(N)c(N)n1 |
| InChI | InChI=1S/C5H7N7/c6-1-10-5-11-3(8)2(7)4(9)12-5/h7H2,(H5,8,9,10,11,12) |
| InChIKey | KRDDJEQAJLQBIO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|